CAS No: 578021-55-3, Chemical Name: 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
the physical and chemical property of 578021-55-3, 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester is provided by ChemNet.com
ChemNet > CAS > 578021-55-3 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
578021-55-3 1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester
| Ονομασία του προϊόντος |
1,4-Piperidinedicarboxylic acid, 4-ethyl-, 1-(1,1-dimethylethyl) 4-methyl ester |
| Συνώνυμα |
methyl n-boc-4-ethylpiperidine-4-carboxylate; piperidine-1,4-dicarboxylic acid |
| MF |
C7H11NO4 |
| Μοριακό βάρος |
173.1665 |
| InChI |
InChI=1/C7H11NO4/c9-6(10)5-1-3-8(4-2-5)7(11)12/h5H,1-4H2,(H,9,10)(H,11,12) |
| CAS ΟΧΙ |
578021-55-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.419g/cm3 |
| Σημείο βρασμού |
391.707°C at 760 mmHg |
| Δείκτης διάθλασης |
1.549 |
| Σημείο ανάφλεξης |
190.698°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
|
|
